Leptomycin B
Leptomycin B (LMB, CI 940, Elactocin, Mantuamycin, NSC 364372) is a potent antifungal antibiotic isolated from Streptomyces and acts as a specific inhibitor of the nuclear export factor CRM1. Leptomycin B rapidly induces cytotoxic effects in cancer cell lines via covalent inhibition of CRM1 with IC50 values of 0.1 nM–10 nM.
| Trivial name | LMB, CI 940, Elactocin, Mantuamycin, NSC 364372 |
| Catalog Number | S7580 |
| Molecular Formula | C33H48O6 |
| CAS# | 87081-35-4 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CCC(/C=C/C1OC(=O)C=CC1C)=C/C(C)C/C=C/C(C)=C/C(C)C(=O)C(C)C(O)C(C)C\C(C)=C\C(O)=O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/leptomycinb.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s7580-leptomycin-b-chemical-structure.gif |