Pyridone 6
Pyridone 6 is a pan-JAK inhibitor with IC50s of 1 nM, 1 nM, 5 nM and 15 nM for JAK2, TYK2, JAK3 and JAK1, respectively.
| Trivial name | JAK Inhibitor I, CMP 6, Compound 6 |
| Catalog Number | S6789 |
| Molecular Formula | C18H16FN3O |
| CAS# | 457081-03-7 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC(C)(C)C1=NC2=C([NH]1)C3=CC=C(F)C=C3C4=C2C=CNC4=O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/jak-inhibitor-i.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s6789-jak-inhibitor-i-pyridone-6--chemical-structure.gif |