Grapiprant (CJ-023,423)
Grapiprant (CJ-023,423, AT-001, AAT-007, RQ-00000007, CJ-23423) is a novel selective EP4 Prostaglandin Receptor inhibitor with Ki of 20 nM and 13 nM for rat EP4 receptor and human EP4 receptor, respectively.
| Trivial name | AT-001, AAT-007, RQ-00000007, CJ-23423 |
| Catalog Number | S6694 |
| Molecular Formula | C26H29N5O3S |
| CAS# | 415903-37-6 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CCC1=NC2=C(N1C3=CC=C(C=C3)CCNC(=O)NS(=O)(=O)C4=CC=C(C=C4)C)C=C(N=C2C)C |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/grapiprant-cj-023423.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s6694-grapiprant-chemical-structure.gif |