Eicosapentaenoic acid ethyl ester
Eicosapentaenoic acid ethyl ester (AMR101, EPA ethyl ester, Ethyl eicosapentaenoate) is an omega-3 fatty acid agent that significantly reduces the triglyceride (TG) levels and improves other lipid parameters without significantly increasing the low-density lipoprotein (LDL) cholesterol levels.
| Trivial name | AMR101, EPA ethyl ester, Ethyl eicosapentaenoate |
| Catalog Number | S6466 |
| Molecular Formula | C22H34O2 |
| CAS# | 86227-47-6 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CCOC(=O)CCC\C=C/C/C=C\C\C=C/C/C=C\C\C=C/CC |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/eicosapentaenoic-acid-ethyl-ester.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s6466-eicosapentaenoic-acid-ethyl-ester-chemical-structure.gif |