HOIPIN-1
HOIPIN-1 (JTP-0819958, HOIP inhibitor-1) is a linear ubiquitin chain assembly complex (LUBAC) inhibitor with an IC50 of 2.8 μM for inhibiting the in vitro linear ubiquitination activity of the petit-LUBAC.
| Trivial name | JTP-0819958, HOIP inhibitor-1 |
| Catalog Number | S6396 |
| Molecular Formula | C17H13NaO4 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | [Na+].COC1=CC=CC=C1C(=O)/C=C/C2=CC=CC=C2C([O-])=O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/hoipin-1.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s6396-hoipin-1-chemical-structure.gif |