CPI-455
CPI-455 is a specific KDM5 inhibitor with an IC50 of 10 nM for full-length KDM5A in enzymatic assays. CPI-455 shows over 200-fold selectivity for KDM5 relative to KDM2, 3, 4, 6, and 7 enzymes.
| Trivial name | N/A |
| Catalog Number | S6389 |
| Molecular Formula | C16H14N4O |
| CAS# | 1628208-23-0 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC(C)C1=C(NC2=C(C=N[N]2C1=O)C#N)C3=CC=CC=C3 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/cpi-455.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s6389-cpi-455-chemical-structure.gif |