CP 43
Cp 43 (Compound 43, TAO Kinase inhibitor 1, TAOK inhibitor 43) is a ATP-competitive and selective TAO Kinase inhibitor with IC50s of 11 nM and 15 nM for TAOK1 and TAOK2, respectively.
| Trivial name | Compound 43, TAO Kinase inhibitor 1, TAOK inhibitor 43, |
| Catalog Number | S6177 |
| Molecular Formula | C25H24N2O2 |
| CAS# | 850467-66-2 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | O=C(CNC(=O)C1=CC=C(C=C1)C2=CC=CC=C2)NC3CCCC4=CC=CC=C34 |
| Size | 10mM/1mL |
| Supplier Page | http://www.selleckchem.com/products/cp-43.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s6177-cp-43-chemical-structure.gif |