Methylprednisolone Acetate
Methylprednisolone (NSC-19987, Medrol) acetate is a synthetic glucocorticoid receptor agonist, used to achieve prompt suppression of inflammation. Methylprednisolone activates ACE2 and reduces IL-6 levels, thus improves severe or critical COVID-19. Methylprednisolone markedly reduces autophagy and apoptosis.
| Trivial name | NSC-19987 acetate, Medrol acetate |
| Catalog Number | S5973 |
| Molecular Formula | C24H32O6 |
| CAS# | 53-36-1 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1CC2C3CCC(O)(C(=O)COC(C)=O)C3(C)CC(O)C2C4(C)C=CC(=O)C=C14 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/methylprednisolone-acetate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s5973-methylprednisolone-acetate-chemical-structure.gif |