Kasugamycin hydrochloride hydrate
Kasugamycin (Ksg) hydrochloride hydrate, an antibiotic which binds both the 30S and 70S ribosome, specifically inhibits translation initiation of canonical but not of leaderless messenger RNAs.
| Trivial name | Ksg hydrochloride hydrate |
| Catalog Number | S5968 |
| Molecular Formula | C14H28ClN3O10 |
| CAS# | 200132-83-8 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | O.Cl.CC1OC(OC2C(O)C(O)C(O)C(O)C2O)C(N)CC1NC(=N)C(O)=O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/kasugamycin-hydrochloride-hydrate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s5968-kasugamycin-hydrochloride-hydrate-chemical-structure.gif |