L-Carnitine hydrochloride
L-Carnitine ((R)-Carnitine, Levocarnitine) hydrochloride improves oxygen saturation, and inhibits leukotriene synthesis. L-Carnitine hydrochloride functions to transport long chain fatty acyl-CoAs into the mitochondria for degradation by β-oxidation.
| Trivial name | (R)-Carnitine hydrochloride, Levocarnitine hydrochloride |
| Catalog Number | S5922 |
| Molecular Formula | C7H16ClNO3 |
| CAS# | 6645-46-1 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | [Cl-].C[N+](C)(C)CC(O)CC(O)=O |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/l-carnitine-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s5922-l-carnitine-hydrochloride-chemical-structure.gif |