KB-R7943 mesylate
KB-R7943 mesylate is a widely used inhibitor of the reverse Na+/Ca2+ exchanger (NCX(rev)) with IC50 of 5.7 μM. KB-R7943 mesylate promotes prostate cancer cell death by activating the JNK pathway and blocking autophagic flux.
| Trivial name | N/A |
| Catalog Number | S4643 |
| Molecular Formula | C17H21N3O6S2 |
| CAS# | 182004-65-5 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | C[S](O)(=O)=O.NC(=N)SCCC1=CC=C(OCC2=CC=C(C=C2)[N+]([O-])=O)C=C1 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/kb-r7943-mesylate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s4643-kb-r7943-mesylate-chemical-structure.gif |