PCNA-I1
PCNA-I1 is a selective inhibitor of proliferating cell nuclear antigen (PCNA, a potential anticancer target). PCNA-I1 selectively binds to PCNA trimers with Kd of ~0.2 to 0.4 μM. PCNA-I1 inhibits the growth of tumor cells of various tissue types with IC50 of ~0.2 μM. PCNA-I1 induces DNA damage and apoptosis in both LNCaP and PC-3 cells. PCNA-I1 also induces autophagy in PC-3 cells.
| Trivial name | N/A |
| Catalog Number | S4476 |
| Molecular Formula | C21H24N4O4 |
| CAS# | 444930-42-1 |
| Inchi | InChI=1S/C21H24N4O4/c1-14-22-17-8-5-4-7-16(17)21(23-14)25(2)15-10-11-18(28-3)19(13-15)29-12-6-9-20(26)24-27/h4-5,7-8,10-11,13,27H,6,9,12H2,1-3H3,(H,24,26) |
| Inchi Key | FWXZZFONXWYSEF-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC=C2C(=N1)N(C)C3=CC(=C(C=C3)OC)OCCCC(=O)NO |
| Size | 10mM/1mL |
| Supplier Page | http://www.selleckchem.com/products/pcna-i1.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s4476-pcna-i1-chemical-structure.gif |
