PCNA-I1
PCNA-I1 is a selective inhibitor of proliferating cell nuclear antigen (PCNA, a potential anticancer target). PCNA-I1 selectively binds to PCNA trimers with Kd of ~0.2 to 0.4 μM. PCNA-I1 inhibits the growth of tumor cells of various tissue types with IC50 of ~0.2 μM. PCNA-I1 induces DNA damage and apoptosis in both LNCaP and PC-3 cells. PCNA-I1 also induces autophagy in PC-3 cells.
| Trivial name | N/A |
| Catalog Number | S4476 |
| Molecular Formula | C17H14N2O2S |
| CAS# | 444930-42-1 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1=C(SC=C1)C(=O)N\N=C\C2=C(O)C3=CC=CC=C3C=C2 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/pcna-i1.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s4476-pcna-i1-chemical-structure.gif |