Almitrine mesylate
Almitrine mesylate (Almitrine bismesylate, Almitrine dimethanesulfonate, Almitrine dimesylate), a pharmacologically unique respiratory stimulant, acts as an agonist of peripheral chemoreceptors located on the carotid bodies. Almitrine mesylate inhibits the activity of Ca2+-dependent K+ channel by decreasing its open probability with IC50 of 0.22 μM.
| Trivial name | Almitrine bismesylate, Almitrine dimethanesulfonate, Almitrine dimesylate |
| Catalog Number | S4439 |
| Molecular Formula | C28H37F2N7O6S2 |
| CAS# | 29608-49-9 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | C[S](O)(=O)=O.C[S](O)(=O)=O.FC1=CC=C(C=C1)C(N2CCN(CC2)C3=NC(=NC(=N3)NCC=C)NCC=C)C4=CC=C(F)C=C4 |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/almitrine-mesylate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s4439-almitrine-mesylate-chemical-structure.gif |