Rifamycin S
Rifamycin S, a quinone and an antibiotic against Gram-positive bacteria (including MRSA), is a clinical drug used to treat tuberculosis and leprosy. Rifamycin S generates reactive oxygen species (ROS) and inhibits microsomal lipid peroxidation.
| Trivial name | N/A |
| Catalog Number | S4425 |
| Molecular Formula | C37H45NO12 |
| CAS# | 13553-79-2 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | COC1\C=C\OC2(C)OC3=C(C2=O)C4=C(C(=C3C)O)C(=O)C(=CC4=O)NC(=O)\C(=C/C=C/C(C)C(O)C(C)C(O)C(C)C(OC(C)=O)C1C)C |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/rifamycin-s.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s4425-rifamycin-s-chemical-structure.gif |