Phenol Red sodium salt
Phenol Red sodium salt (Phenolsulfonephthalein sodium salt) is used ubiquitously as a pH indicator in tissue culture media ranging from 6.8 (yellow) to 8.2 (red). Phenol red binds to the estrogen receptor of MCF-7 human breast cancer cells.
| Trivial name | Phenolsulfonephthalein sodium salt |
| Catalog Number | S4418 |
| Molecular Formula | C19H13NaO5S |
| CAS# | 34487-61-1 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | [Na+].OC1=CC=C(C=C1)C2(O[S](=O)(=O)C3=CC=CC=C23)C4=CC=C([O-])C=C4 |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/phenol-red-sodium-salt.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s4418-phenol-red-sodium-salt-chemical-structure.gif |