CarboxyaMidotriazole orotate
Carboxyamidotriazole Orotate (L-651582 Orotate) is the orotate salt form of Carboxyamidotriazole (CAI), an orally bioavailable signal transduction inhibitor. Carboxyamidotriazole Orotate is a cytostatic inhibitor of nonvoltage-operated calcium channels and calcium channel-mediated signaling pathways. Carboxyamidotriazole Orotate inhibits angiogenesis, tumor growth, invasion, and metastasis.
| Trivial name | L-651582 Orotate, CAI Orotate |
| Catalog Number | S2975 |
| Molecular Formula | C22H16Cl3N7O6 |
| CAS# | 187739-60-2 |
| SMILES | NC(=O)C1=C(N)[N](CC2=CC(=C(C(=C2)Cl)C(=O)C3=CC=C(Cl)C=C3)Cl)N=N1.OC(=O)C4=CC(=O)NC(=O)N4 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/carboxyamidotriazole-orotate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s2975-carboxyamidotriazole-orotate-chemical-structure.png |