Ispinesib (SB-715992)
Ispinesib (SB-715992, CK0238273) is a potent, specific and reversible inhibitor of kinesin spindle protein (KSP) with Ki app of 1.7 nM in a cell-free assay, no inhibition to CENP-E, RabK6, MCAK, MKLP1, KHC or Kif1A. Ispinesib induces mitotic arrest and apoptotic cell death.
| Trivial name | CK0238273 |
| Catalog Number | S1452 |
| Molecular Formula | C18H16FN3O |
| CAS# | 336113-53-2 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC(C)(C)C1=NC2=C([NH]1)C3=CC=C(F)C=C3C4=C2C=CNC4=O |
| Size | 1mg |
| Supplier Page | http://www.selleckchem.com/products/Ispinesib-mesilate(SB-715992).html |
| Additional Information | https://file.selleck.cn/downloads/struct/Ispinesib-SB-715992-chemical-structure-S1452.gif |
