MYCMI-6
MYCMI-6 (NSC354961) is a potent and selective endogenous inhibitor of MYC:MAX protein interactions. MYCMI-6 blocks MYC-driven transcription and binds to the MYC bHLHZip domain with Kd of 1.6 μM. MYCMI-6 inhibits tumor cell growth in a MYC-dependent manner with IC50 of <0.5 μM. MYCMI-6 induces apoptosis.
| Trivial name | NSC354961 |
| Catalog Number | S0987 |
| Molecular Formula | C20H19N7O |
| CAS# | 681282-09-7 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CCOC1=CC2=C(C3=C(C=C(C=C3)N=NC4=C(N=C(C=C4)N)N)N=C2C=C1)N |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/mycmi-6.html |
| Additional Information | https://file.selleck.cn/downloads/struct/S0987-MYCMI-6-chemical-structure.png |