Canertinib dihydrochloride
Canertinib (CI-1033, PD-183805, compound 18) dihydrochloride is a potent and irreversible inhibitor of epidermal growth factor receptor (EGFR) tyrosine kinase. Canertinib dihydrochloride inhibits cellular EGFR and ErbB2 autophosphorylation with IC50 of 7.4 nM and 9 nM, respectively.
| Trivial name | CI-1033 dihydrochloride, PD-183805 dihydrochloride |
| Catalog Number | S0711 |
| Molecular Formula | C24H27Cl3FN5O3 |
| CAS# | 289499-45-2 |
| SMILES | C=CC(=O)NC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)F)Cl)OCCCN4CCOCC4.Cl.Cl |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/canertinib-dihydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s0711-canertinib-dihydrochloride-chemical-structure.gif |