Pu-erh tea Extract
Pu-erh tea Extract is the aqueous extract Pu-erh tea, which can alleviate the intestinal inflammation caused by antibiotics, reduce the degree of intestinal lesions, promote the growth of intestinal probiotics and inhibit pathogenic bacteria.
| Catalog Number | E3545 |
| Molecular Formula | C26H27N3O2 |
| SMILES | CC1=CC=C(C=C1)N2CCN(C(C2)C3=CC=CC=C3)C(=O)C4=CC=C(C=C4)NC(=O)C |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/pu-erh-tea-extract.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e3545-chemical-structure-tube.png |
