Afoxolaner
Afoxolaner (NexGard) is a new insecticide/acaricide molecule from the isoxazoline family that acts on the insect gamma-aminobutyric acid receptor (GABA) and glutamate receptors, inhibiting GABA & glutamate-regulated uptake of chloride ions, resulting in excess neuronal stimulation and death of the arthropod.
| Trivial name | NexGard |
| Catalog Number | E2848 |
| Molecular Formula | C₂₆H₁₇ClF₉N₃O₃ |
| CAS# | 1093861-60-9 |
| SMILES | FC(F)(F)CNC(=O)CNC(=O)C1=CC=C(C2=NOC(C2)(C3=CC(=CC(=C3)Cl)C(F)(F)F)C(F)(F)F)C4=C1C=CC=C4 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/afoxolaner.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e2848-afoxolaner-chemical-structure.png |