Firocoxib (ML 1785713)
Firocoxib (ML 1785713) is a cyclooxygenase (COX)-2 inhibitor and a nonsteroidal anti-inflammatory drug. In vitro firocoxib inhibits COX-1 and COX-2 with an IC50 of 7.5 mM and 0.13 mM respectively in feline blood.
| Trivial name | ML 1785713 |
| Catalog Number | E0500 |
| Molecular Formula | C17H20O5S |
| CAS# | 189954-96-9 |
| SMILES | CC1(C)OC(=O)C(=C1C2=CC=C(C=C2)[S](C)(=O)=O)OCC3CC3 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/firocoxib.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e0500-firocoxib-chemical-structure.gif |