Dansylcadaverine (Monodansyl cadaverine)
Dansylcadaverine (Monodansyl cadaverine, MDC) is an autofluorescent compound used for the labeling of autophagic vacuoles. Dansylcadaverine, a high affinity substrate of transglutaminases, can block the receptor-mediated endocytosis of many ligands.
| Trivial name | MDC, Monodansyl cadaverine |
| Catalog Number | E0451 |
| Molecular Formula | C17H25N3O2S |
| CAS# | 10121-91-2 |
| SMILES | CN(C)C1=CC=CC2=C(C=CC=C12)[S](=O)(=O)NCCCCCN |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/dansylcadaverine-monodansyl-cadaverine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e0451-dansylcadaverine-monodansyl-cadaverine-chemical-structure.gif |