BiP Inducer X (BIX)
BiP Inducer X (BIX) is a selective GRP78 (BiP, HSPA5) inducer. BIX induces BiP only, in a dose-dependent manner, without induction of other molecules involved in the ER stress response.
| Trivial name | N/A |
| Catalog Number | E0362 |
| Molecular Formula | C9H7NO3S |
| CAS# | 101714-41-4 |
| SMILES | OC1=C(O)C=C(C=C1)C(=O)CSC#N |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/bip-inducer-x-bix.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e0362-bix-chemical-structure.gif |