NSC232003
NSC232003 is a highly potent and cell-permeable UHRF1 inhibitor that binds to the 5mC binding pocket of the SRA domain of UHRF1. NSC232003 modulates DNA methylation in a cellular context.
| Trivial name | N/A |
| Catalog Number | E0351 |
| Molecular Formula | C22H21ClN2O4S |
| CAS# | 1905453-18-0 |
| SMILES | CC(C)(C)C1=CC=C(C=C1)[S](=O)(=O)NC2=CC=C(Cl)C=C2C(=O)C3=CC=[N](=O)C=C3 |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/nsc232003.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e0351-nsc232003-chemical-structure.png |