L(+)-Monosodium glutamate monohydrate
L(+)-Monosodium glutamate monohydrate (MSG monohydrate, L-Glutamic acid monosodium salt monohydrate, Monosodium L-glutamate monohydrate, Monosodium L-glutamate monohydrate) is a widespread nutritional additive and flavoring agent. L(+)-Monosodium glutamate monohydrate can lead to oxidative stress-mediated DNA damage and apoptosis.
Trivial name | MSG monohydrate, L-Glutamic acid monosodium salt monohydrate, Monosodium L-glutamate monohydrate, Monosodium L-glutamate monohydrate |
Catalog Number | E0152 |
Molecular Formula | C5H9NO4.H2O.Na |
CAS# | 6106-04-3 |
SMILES | O.[Na+].NC(CCC(O)=O)C([O-])=O |
Size | 5g |
Supplier Page | http://www.selleckchem.com/products/l-monosodium-glutamate-monohydrate.html |
Additional Information | https://file.selleck.cn/downloads/struct/e0152-l-monosodium-glutamate-monohydrate-chemical-structure.gif |