XL092
XL092 (JUN04542) is an ATP-competitive inhibitor of multiple RTKs including MET, VEGFR2, AXL and MER, with IC50 values of 15 nM, 1.6 nM, 3.4 nM, and 7.2 nM in cell-based assays, respectively.
| Trivial name | JUN04542 |
| Catalog Number | E0142 |
| Molecular Formula | C21H18F3N3O5.Na |
| CAS# | 2367004-54-2 |
| SMILES | [NaH].OC1=C2N(CC3OC4CCC(C4)N3C2=O)C=C(C(=O)NCC5=C(F)C=C(F)C=C5F)C1=O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/xl092.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e0142-xl092-chemical-structure.gif |
