4-Vinylcyclohexene dioxide
4-Vinylcyclohexene dioxide (Vinylcyclohexene dioxide, VCD) is a chemical used to induce menopause and decrease estrogen production. 4-Vinylcyclohexene dioxide is used as a crosslinking agent for the production of epoxy resins.
| Trivial name | Vinylcyclohexene dioxide, VCD |
| Catalog Number | E0024 |
| Molecular Formula | C₂₆H₂₅N₅O₃ |
| CAS# | 106-87-6 |
| SMILES | NC1=NC=CC2=C1N(C(=O)N2C3CCCN(C3)C(=O)C=C)C4=CC=C(OC5=CC=CC=C5)C=C4 |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/4-vinylcyclohexene-dioxide.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e0024-vinylcyclohexene-dioxide-chemical-structure.gif |
