4-Vinylcyclohexene dioxide
4-Vinylcyclohexene dioxide (Vinylcyclohexene dioxide, VCD) is a chemical used to induce menopause and decrease estrogen production. 4-Vinylcyclohexene dioxide is used as a crosslinking agent for the production of epoxy resins.
| Trivial name | Vinylcyclohexene dioxide, VCD |
| Catalog Number | E0024 |
| Molecular Formula | C60H101N15O17 |
| CAS# | 106-87-6 |
| SMILES | CCC(C)C(NC(=O)C(NC(=O)C(CC1=CC=CC=C1)NC(=O)C(NC(=O)C(NC(=O)C(CCCCN)NC(=O)C(CCC(O)=O)NC(=O)C(NC(=O)C2CCCN2C(=O)C(CCCNC(N)=N)NC(=O)C(N)CO)C(C)O)C(C)O)C(C)CC)C(C)CC)C(O)=O |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/4-vinylcyclohexene-dioxide.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e0024-vinylcyclohexene-dioxide-chemical-structure.gif |