Beta-Nicotinamide Mononucleotide
NMN (Nicotinamide mononucleotide) is a naturally occurring biologically active nucleotide, known as “β-nicotinamide mononucleotide”. Since nicotinamide belongs to vitamin B3, NMN belongs to the category of vitamin B derivatives, which are widely involved in many biochemical reactions in human body and are closely related to immunity and metabolism.
NMN is a nutrient that is converted into NAD+ in cells, it is classified as a new type of vitamin B3 and goes beyond the effects of ordinary vitamins and is considered a preventive and rejuvenating supplement for aging.NMN itself is a substance contained in the human body and is present in breast milk and in foods such as mauve beans, broccoli, cucumber, cabbage, avocados, tomatoes, etc., but in very small amounts (0.25-1 per 100 0.25-1.88 mg per 100 g). Raw beef and shrimp, etc. also contain very small amounts (0.06-0.42 mg per 100 g) of NMN.
Catalog Number | ABA-094 |
Alternative Name(s) | β-Nicotinamide MononucleotideNMN |
CAS# | 1094-61-7 |
SMILES | NC(C1=C[N+]([C@@H]2O[C@H](COP(O)([O-])=O)[C@@H](O)[C@H]2O)=CC=C1)=O |
Size | Inquiry |
Supplier Page | https://www.agingclocks.com/beta-nicotinamide-mononucleotide-item-1963.html |