(-)-Epigallocatechin gallate
A polyphenol flavonoid that displays antitumor and antioxidant properties. Inhibits telomerase and DNA methyltransferase (DNMT) and blocks the activation of EGF receptors and HER-2 receptors. Also potently and specifically inhibits chymotrypsin-like activity of the proteasome in vitro (IC50= 86-194 nM) and in vivo (IC50 =1 -10 µM).
| Catalog Number | ABA-001 |
| Alternative Name(s) | EGCG; (2R,3R)-2-(3,4,5-Trihydroxyphenyl)-3,4-dihydro-1[2H]-benzopyran-3,5,7-triol 3-(3,4,5-trihydroxybenzoate) |
| CAS# | 989-51-5 |
| Inchi | InChI=1S/C22H18O11/c23-10-5-12(24)11-7-18(33-22(31)9-3-15(27)20(30)16(28)4-9)21(32-17(11)6-10)8-1-13(25)19(29)14(26)2-8/h1-6,18,21,23-30H,7H2/t18-,21-/m1/s1 |
| Inchi Key | WMBWREPUVVBILR-WIYYLYMNSA-N |
| SMILES | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O |
| Size | Inquiry |
| Supplier Page | https://www.agingclocks.com/--epigallocatechin-gallate-item-1368.html |