Mastoparan B | MedChemExpress (MCE)
Mastoparan B is an antimicrobial peptide derived from hornet Vespa. Mastoparan B can cause the shape of red blood cells to change from normal disk-like to serrated[1].
Trivial name | Mastoparan B |
Catalog Number | HY-P5602 |
Research Area | Infection |
CAS# | 137354-65-5 |
Purity | ≥98.00% |
SMILES | CC(C)C[C@H](N)C(N[C@@H](CCCCN)C(N[C@@H](CC(C)C)C(N[C@@H](CCCCN)C(N[C@@H](CO)C(N[C@@H]([C@@H](C)CC)C(N[C@@H](C(C)C)C(N[C@@H](CO)C(N[C@H](C(N[C@@H](C)C(N[C@@H](CCCCN)C(N[C@@H](CCCCN)C(N[C@@H](C(C)C)C(N[C@H](C(N)=O)CC(C)C)=O)=O)=O)=O)=O)CC1=CNC2=CC=CC=C12)=O)=O)=O)=O)=O)=O)=O)=O |
PubChem Chemical Structure ID | 86289587 |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/mastoparan-b.html |