LSD1-IN-24 | MedChemExpress (MCE)
LSD1-IN-24(compound 3S) is a selective LSD1 inhibitor with IC50 = 0.247 μM. LSD1-IN-24 can mediate the expression of PD-L1, enhance T cell killing response, and can be used in cancer research[1].
Trivial name | LSD1-IN-24 |
Catalog Number | HY-149213 |
Research Area | Cancer |
CAS# | 4734-59-2 |
Purity | 99.20% |
SMILES | N1(CCN2C3=C(SC4=C2C=CC=C4)C=CC=C3)CCOCC1 |
PubChem Chemical Structure ID | 458780 |
Size | 10 mM * 1 mL |
Supplier Page | https://www.medchemexpress.com/lsd1-in-24.html |