(+)-Bornyl Acetate
(+)-Bornyl Acetate has a stronger inhibitory effect on root growth of Arabidopsis seedlings.
| Catalog Number | T8283 |
| Alternative Name(s) | Bornyl acetate |
| Research Area | Others |
| Molecular Formula | C12H20O2 |
| CAS# | 20347-65-3 |
| SMILES | CC(C)([C@H](CC1)C2)[C@]1(C)[C@H]2OC(C)=O |
| Size | 25 mg |
| Supplier Page | https://www.targetmol.com/compound/Bornyl acetate--- |
| Additional Information | https://www.targetmol.com/datasheet/T8283 |
