Calcium Channel antagonist 2
Calcium Channel antagonist 2 is a calcium channel antagonist (IC50=5-20 μM) that can be used to study diseases due to Ca2+ channels like pain and diabetes.
| Catalog Number | T77710 |
| Alternative Name(s) | WAY-327363 |
| Research Area | Membrane transporter/Ion channel|||Metabolism |
| Molecular Formula | C23H25FN2O4S |
| CAS# | 874370-15-7 |
| SMILES | O=C(NCC1=CC=C(F)C=C1)C=2OC=3C=CC(=CC3C2C)S(=O)(=O)N4CCC(C)CC4 |
| Size | 10 mg |
| Supplier Page | https://www.targetmol.com/compound/calcium_channel_antagonist_2 |
| Additional Information | https://www.targetmol.com/datasheet/T77710 |