(-)-α-Terpineol
(-)-α-Terpineol has antitumour, anti-inflammatory, and antimicrobial activities, it inhibits the growth of tumour cells through a mechanism that involves inhibition of the NF-kappaB pathway
| Catalog Number | T7468 |
| Alternative Name(s) | α-Terpineol |
| Research Area | Others |
| Molecular Formula | C10H18O |
| CAS# | 10482-56-1 |
| Purity | 98.00% |
| SMILES | CC1=CC[C@@H](C(C)(C)O)CC1 |
| Size | 25 g |
| Supplier Page | https://www.targetmol.com/compound/(-)-α-Terpineol |
| Additional Information | https://www.targetmol.com/datasheet/T7468 |
