BODIPY-FL
BODIPY-FL is a broad-spectrum and effective fluorescent dye that can be used to label probes or primers and is a compound for the quantitative detection of specific DNA/RNA based on fluorescence bursts.BODIPY-FL-labelled monoterpenes can be used to detect Gram-positive and Gram-negative bacteria as characteristic and pathogenic fungi.
| Catalog Number | T66518 |
| Alternative Name(s) | BDP FL acid |
| Molecular Formula | C14H15BF2N2O2 |
| CAS# | 165599-63-3 |
| Purity | 99.05% |
| SMILES | [H+].O=C([O-])CCC1=CC=C2C=C3C(=CC(=[N]3[B+3]([F-])([F-])[N-]21)C)C |
| Size | 25 mg |
| Supplier Page | https://www.targetmol.com/compound/bodipy-fl |
| Additional Information | https://www.targetmol.com/datasheet/T66518 |
