(+)-(3R,8S)-Falcarindiol
1. (+)-(3R,8S)-Falcarindiol is a potential new anticancer agent that exerts its activity through inducing ER stress and apoptosis. 2. Falcarindiol induces immunosuppressive effects in vitro and in vivo and might be a novel therapy for autoimmune or allergic diseases. 3. Falcarindiol has protective effect against CCl(4) toxicity , in part, be explained by anti-lipid peroxidation activity associated with the induction of the GSTs including GSTA4.
| Catalog Number | T5S1285 |
| Alternative Name(s) | Falcarindiol |
| Research Area | Others |
| Molecular Formula | C17H24O2 |
| CAS# | 225110-25-8 |
| Purity | 100.00% |
| SMILES | CCCCCCC\C=C/[C@H](O)C#CC#C[C@H](O)C=C |
| Size | 25 mg |
| Supplier Page | https://www.targetmol.com/compound/(+)-(3R,8S)-Falcarindiol |
| Additional Information | https://www.targetmol.com/datasheet/T5S1285 |
