Alisol B
Alisol B may be a potential novel therapeutic molecule for bone disorders through targeting the differentiation of osteoclasts as well as their functions. Alisol B also inhibited RANKL-induced expression of NFATc1 and c-Fos, which are key transcription factors for osteoclastogenesis.
| Catalog Number | T5770 |
| Research Area | NF-Κb |
| Molecular Formula | C30H48O4 |
| CAS# | 18649-93-9 |
| Purity | 99.77% |
| SMILES | [H][C@@]1(OC1(C)C)[C@@H](O)C[C@@H](C)C1=C2C[C@H](O)[C@@]3([H])[C@@]4(C)CCC(=O)C(C)(C)[C@]4([H])CC[C@]3(C)[C@@]2(C)CC1 |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/Alisol B |
| Additional Information | https://www.targetmol.com/datasheet/T5770 |