[D-Trp11]-Neurotensin
[D-Trp11]-Neurotensin is a compound that functions as a selective antagonist of Neurotensin (NT) in perfused rat hearts, while exhibiting full agonist properties in guinea pig atria and rat stomach strips. Additionally, this compound can inhibit hypotension induced by NT.
| Catalog Number | T40850 |
| Alternative Name(s) | [D-Trp11]-Neurotensin |
| Molecular Formula | C80H122N22O19 |
| CAS# | 73634-68-1 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCCN)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H]1CCC(=O)N1)C(=O)N[C@@H](CC(C)C)C(O)=O |
| Size | 5 mg |
| Supplier Page | https://www.targetmol.com/compound/_d-trp11_-neurotensin |
| Additional Information | https://www.targetmol.com/datasheet/T40850 |
