β-D-Glucopyranosyl abscisate
β-D-Glucopyranosyl abscisate (ABA-GE) is a hydrolyzable conjugate of abscisic acid (ABA), which predominantly accumulates in the vacuole and likely in the endoplasmic reticulum. The deconjugation of β-D-Glucopyranosyl abscisate enables a swift release of free ABA in response to abiotic stress factors like dehydration and salt stress. β-D-Glucopyranosyl abscisate plays a crucial role in maintaining ABA homeostasis.
| Catalog Number | T39605 |
| Alternative Name(s) | ABA-GE , β-D-Glucopyranosyl abscisate , (S)-cis,trans-Abscisicacidglucosylester |
| Molecular Formula | C21H30O9 |
| CAS# | 21414-42-6 |
| SMILES | O(C(/C=C(\C=C\[C@]1(O)C(C)(C)CC(=O)C=C1C)/C)=O)[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O |
| Size | 1 mg |
| Supplier Page | https://www.targetmol.com/compound/β-d-glucopyranosyl_abscisate |
| Additional Information | https://www.targetmol.com/datasheet/T39605 |