β-catenin-IN-37
β-Catenin-IN-37 is a selective inhibitor of the protein-protein interaction between β-Catenin and T-cell factor (Tcf), known as β-catenin/Tcf PPI. It effectively inhibits canonical Wnt signaling and impedes the growth of colorectal cancer cells SW480 and HCT116, with IC50 values of 20 μM and 31 μM, respectively.
| Catalog Number | T39200 |
| Molecular Formula | C13H9N9O |
| CAS# | 1783856-40-5 |
| SMILES | C(Cn1c2ccccc2c2nc3nonc3nc12)c1nnn[nH]1 |
| Size | 5 mg |
| Supplier Page | https://www.targetmol.com/compound/β-catenin-in-37 |
| Additional Information | https://www.targetmol.com/datasheet/T39200 |