β-D-tetraacetylgalactopyranoside-PEG1-N3
β-D-tetraacetylgalactopyranoside-PEG1-N3 is a cleavable linker involving a one-unit polyethylene glycol (PEG) compound, employed during the synthesis of antibody-drug conjugates (ADCs). It serves as a crucial component in the formation of ADCs.
Catalog Number | T39016 |
Alternative Name(s) | β-D-tetraacetylgalactopyranoside-PEG1-N3 |
Molecular Formula | C18H27N3O11 |
CAS# | 153252-36-9 |
SMILES | CC(=O)OC[C@H]1O[C@@H](OCCOCCN=[N+]=[N-])[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
Size | 500 mg |
Supplier Page | https://www.targetmol.com/compound/β-d-tetraacetylgalactopyranoside-peg1-n3 |
Additional Information | https://www.targetmol.com/datasheet/T39016 |