(+)-Carbovir
(+)-Carbovir is a nucleoside analog with increased chemical stability and increased metabolic stability.
| Catalog Number | T29244 |
| Alternative Name(s) | L-Carbovir |
| Molecular Formula | C11H13N5O2 |
| CAS# | 124915-24-8 |
| SMILES | O=C1C2=C(N(C=N2)[C@H]3C[C@@H](CO)C=C3)NC(N)=N1 |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/(+)-Carbovir |
| Additional Information | https://www.targetmol.com/datasheet/T29244 |
