(±)-J 113397
(±)-J-113397 is a potent and selective non-peptidyl ORL1 receptor antagonist (K(i): cloned human ORL1=1.8 nM). J-113397 inhibited nociceptin/orphanin FQ-stimulated GTPγS binding to CHO cells expressing ORL1 with an IC 50 value of 5.3 nM. J-113397 can be used for researching the physiological roles of nociceptin/orphanin FQ [1].
| Catalog Number | T21999 |
| Molecular Formula | C24H37N3O2 |
| CAS# | 217461-40-0 |
| SMILES | O=C1N(C=2C(N1CC)=CC=CC2)[C@@H]3[C@@H](CO)CN(CC4CCCCCCC4)CC3 |
| Size | 50 mg |
| Supplier Page | https://www.targetmol.com/compound/(±)-j_113397 |
| Additional Information | https://www.targetmol.com/datasheet/T21999 |
