β-Tocotrienol
Beta-Tocotrienol to serve as a new anticancer agent for treating human lung and brain cancers. It inhibits the growth of both A549 (GI50=1.38±0.334μM) and U87MG (GI50=2.53±0.604μM) cells at rather low concentrations.
| Catalog Number | T21523 |
| Alternative Name(s) | Beta-Tocotrienol |
| Research Area | Proteases/Proteasome|||Apoptosis |
| Molecular Formula | C28H42O2 |
| CAS# | 490-23-3 |
| SMILES | C\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC[C@]1(C)CCc2c(C)c(O)cc(C)c2O1 |
| Size | 50 mg |
| Supplier Page | https://www.targetmol.com/compound/β-Tocotrienol |
| Additional Information | https://www.targetmol.com/datasheet/T21523 |