(+)-Dropropizine
(+)-Dropropizine can inhibit histamine receptor, anti-allergic, and reduce a cough by modulation of neuropeptides involved in the cough reflex and by interfering with stimulus activation of peripheral endings of sensory nerves.
                    | Catalog Number | T0217L | 
| Alternative Name(s) | (+)-Dropropizine | 
| Research Area | Neuroscience|||Immunology/Inflammation|||GPCR/G Protein | 
| Molecular Formula | C13H20N2O2 | 
| CAS# | 99291-24-4 | 
| Purity | 99.92% | 
| SMILES | OC[C@H](O)CN1CCN(CC1)c1ccccc1 | 
| Size | 1 g | 
| Supplier Page | https://www.targetmol.com/compound/Levodropropizine | 
| Additional Information | https://www.targetmol.com/datasheet/T0217L | 
                    