N-Acetylsulfanilyl chloride
| Catalog Number | CBB1356948ATL |
| Molecular Formula | C8 H8 Cl N O3 S |
| CAS# | 121-60-8 |
| Purity | >95% |
| Size | Inquiry |
| Supplier Page | https://www.amerigoscientific.com/n-acetylsulfanilyl-chloride-item-356948.html |
N-Acetylsulfanilyl chloride
L-hydroxyproline has been derivatized with N-acetylsulfanilyl chloride and 5-chlorovaleric acid during the synthesis of the haptens HP1 and HP2.
| Catalog Number | CBB1112798 |
| Alternative Name(s) | 4-Acetamidobenzenesulfonyl chloride |
| Molecular Formula | 4-(CH3CONH)C6H4SO2Cl |
| CAS# | 121-60-8 |
| Purity | >98% |
| Inchi | 1S/C8H8ClNO3S/c1-6(11)10-7-2-4-8(5-3-7)14(9,12)13/h2-5H,1H3,(H,10,11) |
| Inchi Key | GRDXCFKBQWDAJH-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(cc1)S(Cl)(=O)=O |
| Size | Inquiry |
| Supplier Page | https://www.amerigoscientific.com/n-acetylsulfanilyl-chloride-item-112798.html |