tert-Butyl N-(benzyloxy)carbamate
tert-Butyl N-(benzyloxy)carbamate (tert-butyl benzyloxycarbamate), a protected hydroxylamine, is an N-alkyl-N-benzyloxy carbamate. Its C-N cross coupling reaction with fluorescein ditriflate has been reported. It participates in facile intramolecular cyclization with various carbon nucleophiles to afford functionalized 5- and 6-membered protected cyclic hydroxamic acids.
Catalog Number | CBB1119551 |
Molecular Formula | C6H5CH2ONHCO2C(CH3)3 |
CAS# | 79722-21-7 |
Purity | >99% |
Inchi | 1S/C12H17NO3/c1-12(2,3)16-11(14)13-15-9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H,13,14) |
Inchi Key | MZNBNPWFHGWAGH-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)NOCc1ccccc1 |
Size | Inquiry |
Supplier Page | https://www.amerigoscientific.com/tert-butyl-n-benzyloxycarbamate-item-119551.html |